C27H29N3 — CID 50866323
4-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-N-phenylaniline (PubChem CID 50866323) has the molecular formula C27H29N3 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-N-phenylaniline.
| Compound Name | 4-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-N-phenylaniline |
|---|---|
| PubChem CID | 50866323 |
| Molecular Formula | C27H29N3 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 4-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-N-phenylaniline |
| SMILES | CCN1c2ccc(/C=N/c3ccc(Nc4ccccc4)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C27H29N3/c1-5-30-26-16-11-21(17-25(26)20(2)18-27(30,3)4)19-28-22-12-14-24(15-13-22)29-23-9-7-6-8-10-23/h6-19,29H,5H2,1-4H3/b28-19+ |
| InChIKey | LZVJEPXYTLFDMK-TURZUDJPSA-N |
| XLogP | 7.20 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|