C25H34N2 — CID 3832411
N-(1-adamantyl)-1-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methanimine (PubChem CID 3832411) has the molecular formula C25H34N2 and a molecular weight of 362.56 g/mol. Its IUPAC name is N-(1-adamantyl)-1-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methanimine.
| Compound Name | N-(1-adamantyl)-1-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 3832411 |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | N-(1-adamantyl)-1-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methanimine |
| SMILES | CCN1c2ccc(/C=N/C34CC5CC(CC(C5)C3)C4)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H34N2/c1-5-27-23-7-6-18(11-22(23)17(2)12-24(27,3)4)16-26-25-13-19-8-20(14-25)10-21(9-19)15-25/h6-7,11-12,16,19-21H,5,8-10,13-15H2,1-4H3/b26-16+ |
| InChIKey | RRKPJTOBPIJDGC-WGOQTCKBSA-N |
| XLogP | 6.10 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|