C20H25N3OS — CID 50866051
(5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 50866051) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50866051 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | CCN1c2ccc(/C=C3/S/C(=N\C)N(C)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C20H25N3OS/c1-7-23-16-9-8-14(10-15(16)13(2)12-20(23,3)4)11-17-18(24)22(6)19(21-5)25-17/h8-12H,7H2,1-6H3/b17-11+,21-19- |
| InChIKey | VJNJCQKLTZNXEA-SMSCYPBYSA-N |
| XLogP | 4.24 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|