C27H31N3OS — CID 50866020
(5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one (PubChem CID 50866020) has the molecular formula C27H31N3OS and a molecular weight of 445.63 g/mol. Its IUPAC name is (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50866020 |
| Molecular Formula | C27H31N3OS |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C\c2ccc3c(c2)C(C)=CC(C)(C)N3CC)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C27H31N3OS/c1-6-15-29-25(31)24(32-26(29)28-21-11-9-8-10-12-21)17-20-13-14-23-22(16-20)19(3)18-27(4,5)30(23)7-2/h8-14,16-18H,6-7,15H2,1-5H3/b24-17+,28-26- |
| InChIKey | POPFFTGKMYRTFP-PIDRKRQWSA-N |
| XLogP | 6.72 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|