C22H28N2O2S — CID 50868411
(5E)-3-propyl-5-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 50868411) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is (5E)-3-propyl-5-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-propyl-5-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 50868411 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (5E)-3-propyl-5-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN1C(=O)S/C(=C/c2ccc3c(c2)C(C)=CC(C)(C)N3CCC)C1=O |
| InChI | InChI=1S/C22H28N2O2S/c1-6-10-23-20(25)19(27-21(23)26)13-16-8-9-18-17(12-16)15(3)14-22(4,5)24(18)11-7-2/h8-9,12-14H,6-7,10-11H2,1-5H3/b19-13+ |
| InChIKey | LHTXCTNOBCRQKC-CPNJWEJPSA-N |
| XLogP | 5.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|