C29H34N2O3S — CID 50868577
(5E)-3-[2-(4-methylphenoxy)ethyl]-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 50868577) has the molecular formula C29H34N2O3S and a molecular weight of 490.67 g/mol. Its IUPAC name is (5E)-3-[2-(4-methylphenoxy)ethyl]-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(4-methylphenoxy)ethyl]-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 50868577 |
| Molecular Formula | C29H34N2O3S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | (5E)-3-[2-(4-methylphenoxy)ethyl]-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN1c2cc(C)c(/C=C3/SC(=O)N(CCOc4ccc(C)cc4)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C29H34N2O3S/c1-7-12-31-25-15-20(3)22(16-24(25)21(4)18-29(31,5)6)17-26-27(32)30(28(33)35-26)13-14-34-23-10-8-19(2)9-11-23/h8-11,15-18H,7,12-14H2,1-6H3/b26-17+ |
| InChIKey | XPNSEIPWVPENOX-YZSQISJMSA-N |
| XLogP | 6.83 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|