C29H36N2O4S — CID 50864020
(5E)-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[2-(4-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 50864020) has the molecular formula C29H36N2O4S and a molecular weight of 508.68 g/mol. Its IUPAC name is (5E)-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[2-(4-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[2-(4-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 50864020 |
| Molecular Formula | C29H36N2O4S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (5E)-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[2-(4-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN1c2cc(OC)c(/C=C3/SC(=O)N(CCOc4ccc(C)cc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C29H36N2O4S/c1-7-12-31-24-17-25(34-6)21(15-23(24)20(3)18-29(31,4)5)16-26-27(32)30(28(33)36-26)13-14-35-22-10-8-19(2)9-11-22/h8-11,15-17,20H,7,12-14,18H2,1-6H3/b26-16+ |
| InChIKey | JWIFWHAUWONIHI-WGOQTCKBSA-N |
| XLogP | 6.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|