C28H34N2O3S — CID 50862236
(5E)-3-[2-(4-methylphenoxy)ethyl]-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 50862236) has the molecular formula C28H34N2O3S and a molecular weight of 478.66 g/mol. Its IUPAC name is (5E)-3-[2-(4-methylphenoxy)ethyl]-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(4-methylphenoxy)ethyl]-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 50862236 |
| Molecular Formula | C28H34N2O3S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (5E)-3-[2-(4-methylphenoxy)ethyl]-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN1c2ccc(/C=C3/SC(=O)N(CCOc4ccc(C)cc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C28H34N2O3S/c1-6-13-30-24-12-9-21(16-23(24)20(3)18-28(30,4)5)17-25-26(31)29(27(32)34-25)14-15-33-22-10-7-19(2)8-11-22/h7-12,16-17,20H,6,13-15,18H2,1-5H3/b25-17+ |
| InChIKey | CAZHFVALMNPZNT-KOEQRZSOSA-N |
| XLogP | 6.61 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|