C26H28ClFN2O2S — CID 50862213
(5E)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 50862213) has the molecular formula C26H28ClFN2O2S and a molecular weight of 487.04 g/mol. Its IUPAC name is (5E)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 50862213 |
| Molecular Formula | C26H28ClFN2O2S |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | (5E)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN1c2ccc(/C=C3/SC(=O)N(Cc4c(F)cccc4Cl)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C26H28ClFN2O2S/c1-5-11-30-22-10-9-17(12-18(22)16(2)14-26(30,3)4)13-23-24(31)29(25(32)33-23)15-19-20(27)7-6-8-21(19)28/h6-10,12-13,16H,5,11,14-15H2,1-4H3/b23-13+ |
| InChIKey | MLZKKZJOPQNEMQ-YDZHTSKRSA-N |
| XLogP | 7.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|