C20H15ClFN3O3S — CID 1498941
(5Z)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 1498941) has the molecular formula C20H15ClFN3O3S and a molecular weight of 431.88 g/mol. Its IUPAC name is (5Z)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1498941 |
| Molecular Formula | C20H15ClFN3O3S |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | (5Z)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cn1c(=O)n(C)c2cc(/C=C3\SC(=O)N(Cc4c(F)cccc4Cl)C3=O)ccc21 |
| InChI | InChI=1S/C20H15ClFN3O3S/c1-23-15-7-6-11(8-16(15)24(2)19(23)27)9-17-18(26)25(20(28)29-17)10-12-13(21)4-3-5-14(12)22/h3-9H,10H2,1-2H3/b17-9- |
| InChIKey | MZCFCZVAYFMRNP-MFOYZWKCSA-N |
| XLogP | 3.91 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|