C22H28N2OS2 — CID 50862307
(5E)-3-prop-2-enyl-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 50862307) has the molecular formula C22H28N2OS2 and a molecular weight of 400.61 g/mol. Its IUPAC name is (5E)-3-prop-2-enyl-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-prop-2-enyl-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50862307 |
| Molecular Formula | C22H28N2OS2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (5E)-3-prop-2-enyl-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C\c2ccc3c(c2)C(C)CC(C)(C)N3CCC)SC1=S |
| InChI | InChI=1S/C22H28N2OS2/c1-6-10-23-20(25)19(27-21(23)26)13-16-8-9-18-17(12-16)15(3)14-22(4,5)24(18)11-7-2/h6,8-9,12-13,15H,1,7,10-11,14H2,2-5H3/b19-13+ |
| InChIKey | KFLZPYWXEWBMRI-CPNJWEJPSA-N |
| XLogP | 5.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|