C32H33N3O2S — CID 50862342
1,3-diphenyl-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-4,6-dione (PubChem CID 50862342) has the molecular formula C32H33N3O2S and a molecular weight of 523.70 g/mol. Its IUPAC name is 1,3-diphenyl-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-diphenyl-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 50862342 |
| Molecular Formula | C32H33N3O2S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 1,3-diphenyl-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-4,6-dione |
| SMILES | CCCN1c2ccc(C=C3C(=O)N(c4ccccc4)C(=S)N(c4ccccc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C32H33N3O2S/c1-5-18-33-28-17-16-23(19-26(28)22(2)21-32(33,3)4)20-27-29(36)34(24-12-8-6-9-13-24)31(38)35(30(27)37)25-14-10-7-11-15-25/h6-17,19-20,22H,5,18,21H2,1-4H3 |
| InChIKey | KATULOIDNLPVBC-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|