C33H35N3O3S — CID 50863955
5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 50863955) has the molecular formula C33H35N3O3S and a molecular weight of 553.73 g/mol. Its IUPAC name is 5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 50863955 |
| Molecular Formula | C33H35N3O3S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCN1c2cc(OC)c(C=C3C(=O)N(c4ccccc4)C(=S)N(c4ccccc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C33H35N3O3S/c1-6-17-34-28-20-29(39-5)23(18-26(28)22(2)21-33(34,3)4)19-27-30(37)35(24-13-9-7-10-14-24)32(40)36(31(27)38)25-15-11-8-12-16-25/h7-16,18-20,22H,6,17,21H2,1-5H3 |
| InChIKey | KCRAJARSJSKSDH-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|