C28H32BrN3O4 — CID 50863813
(5Z)-1-(4-bromo-2-methylphenyl)-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 50863813) has the molecular formula C28H32BrN3O4 and a molecular weight of 554.49 g/mol. Its IUPAC name is (5Z)-1-(4-bromo-2-methylphenyl)-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(4-bromo-2-methylphenyl)-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50863813 |
| Molecular Formula | C28H32BrN3O4 |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | (5Z)-1-(4-bromo-2-methylphenyl)-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCN1c2cc(OC)c(/C=C3/C(=O)NC(=O)N(c4ccc(Br)cc4C)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C28H32BrN3O4/c1-7-10-31-23-14-24(36-6)18(12-20(23)17(3)15-28(31,4)5)13-21-25(33)30-27(35)32(26(21)34)22-9-8-19(29)11-16(22)2/h8-9,11-14,17H,7,10,15H2,1-6H3,(H,30,33,35)/b21-13- |
| InChIKey | NZJFQQRIOZOGIQ-BKUYFWCQSA-N |
| XLogP | 5.93 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|