C26H28FN3O4 — CID 50861759
(5Z)-5-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 50861759) has the molecular formula C26H28FN3O4 and a molecular weight of 465.53 g/mol. Its IUPAC name is (5Z)-5-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50861759 |
| Molecular Formula | C26H28FN3O4 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (5Z)-5-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1c2cc(OC)c(/C=C3/C(=O)NC(=O)N(c4ccccc4F)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C26H28FN3O4/c1-6-29-21-13-22(34-5)16(11-17(21)15(2)14-26(29,3)4)12-18-23(31)28-25(33)30(24(18)32)20-10-8-7-9-19(20)27/h7-13,15H,6,14H2,1-5H3,(H,28,31,33)/b18-12- |
| InChIKey | GIBDATTWXUBQSM-PDGQHHTCSA-N |
| XLogP | 4.61 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|