C28H30ClN3O4S — CID 50869134
2-[(5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 50869134) has the molecular formula C28H30ClN3O4S and a molecular weight of 540.09 g/mol. Its IUPAC name is 2-[(5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 50869134 |
| Molecular Formula | C28H30ClN3O4S |
| Molecular Weight | 540.09 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-[(5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | CCCN1c2cc(Cl)c(/C=C3/SC(=O)N(CC(=O)Nc4ccc(OC)cc4)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C28H30ClN3O4S/c1-6-11-32-23-14-22(29)18(12-21(23)17(2)15-28(32,3)4)13-24-26(34)31(27(35)37-24)16-25(33)30-19-7-9-20(36-5)10-8-19/h7-10,12-15H,6,11,16H2,1-5H3,(H,30,33)/b24-13+ |
| InChIKey | MZOSWLFHXPGAER-ZMOGYAJESA-N |
| XLogP | 6.44 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.09 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|