C26H26FN3O3S — CID 50864807
2-[(5E)-2,4-dioxo-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 50864807) has the molecular formula C26H26FN3O3S and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[(5E)-2,4-dioxo-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(5E)-2,4-dioxo-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 50864807 |
| Molecular Formula | C26H26FN3O3S |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 2-[(5E)-2,4-dioxo-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CC1=CC(C)(C)N(C)c2cc(C)c(/C=C3/SC(=O)N(CC(=O)Nc4ccc(F)cc4)C3=O)cc21 |
| InChI | InChI=1S/C26H26FN3O3S/c1-15-10-21-20(16(2)13-26(3,4)29(21)5)11-17(15)12-22-24(32)30(25(33)34-22)14-23(31)28-19-8-6-18(27)7-9-19/h6-13H,14H2,1-5H3,(H,28,31)/b22-12+ |
| InChIKey | SHNNOIVTTBVCTL-WSDLNYQXSA-N |
| XLogP | 5.44 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|