C27H27Cl2N3O3S — CID 50869126
N-(3-chlorophenyl)-2-[(5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 50869126) has the molecular formula C27H27Cl2N3O3S and a molecular weight of 544.50 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 50869126 |
| Molecular Formula | C27H27Cl2N3O3S |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCCN1c2cc(Cl)c(/C=C3/SC(=O)N(CC(=O)Nc4cccc(Cl)c4)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C27H27Cl2N3O3S/c1-5-9-32-22-13-21(29)17(10-20(22)16(2)14-27(32,3)4)11-23-25(34)31(26(35)36-23)15-24(33)30-19-8-6-7-18(28)12-19/h6-8,10-14H,5,9,15H2,1-4H3,(H,30,33)/b23-11+ |
| InChIKey | STCHXHXHBLIJCR-FOKLQQMPSA-N |
| XLogP | 7.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|