C20H21FN2O4S — CID 50865671
methyl 2-[(5Z)-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 50865671) has the molecular formula C20H21FN2O4S and a molecular weight of 404.46 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(5Z)-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 50865671 |
| Molecular Formula | C20H21FN2O4S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | methyl 2-[(5Z)-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)S/C(=C\c2cc3c(cc2F)N(C)C(C)(C)C=C3C)C1=O |
| InChI | InChI=1S/C20H21FN2O4S/c1-11-9-20(2,3)22(4)15-8-14(21)12(6-13(11)15)7-16-18(25)23(19(26)28-16)10-17(24)27-5/h6-9H,10H2,1-5H3/b16-7- |
| InChIKey | AMLYLVFXYSQZRF-APSNUPSMSA-N |
| XLogP | 3.67 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|