C22H26N2O4S — CID 99887355
propan-2-yl 2-[(5E)-2,4-dioxo-5-[(1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 99887355) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-2,4-dioxo-5-[(1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-2,4-dioxo-5-[(1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 99887355 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | propan-2-yl 2-[(5E)-2,4-dioxo-5-[(1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC1=CC(C)(C)N(C)c2ccc(/C=C3/SC(=O)N(CC(=O)OC(C)C)C3=O)cc21 |
| InChI | InChI=1S/C22H26N2O4S/c1-13(2)28-19(25)12-24-20(26)18(29-21(24)27)10-15-7-8-17-16(9-15)14(3)11-22(4,5)23(17)6/h7-11,13H,12H2,1-6H3/b18-10+ |
| InChIKey | FRLHTWLMHODYFV-VCHYOVAHSA-N |
| XLogP | 4.31 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|