C25H27N3OS — CID 50866104
(5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 50866104) has the molecular formula C25H27N3OS and a molecular weight of 417.58 g/mol. Its IUPAC name is (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50866104 |
| Molecular Formula | C25H27N3OS |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCN1c2ccc(/C=C3/S/C(=N\c4ccccc4)N(C)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H27N3OS/c1-6-28-21-13-12-18(14-20(21)17(2)16-25(28,3)4)15-22-23(29)27(5)24(30-22)26-19-10-8-7-9-11-19/h7-16H,6H2,1-5H3/b22-15+,26-24- |
| InChIKey | RSQBPOKEFNIZJX-GCXIQGEKSA-N |
| XLogP | 5.94 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|