C29H33FN4O2S — CID 50867607
(5E)-5-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 50867607) has the molecular formula C29H33FN4O2S and a molecular weight of 520.67 g/mol. Its IUPAC name is (5E)-5-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50867607 |
| Molecular Formula | C29H33FN4O2S |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | (5E)-5-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylidene]-3-methyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1c2cc(F)c(/C=C3/S/C(=N\c4ccc(N5CCOCC5)cc4)N(C)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C29H33FN4O2S/c1-6-34-25-17-24(30)20(15-23(25)19(2)18-29(34,3)4)16-26-27(35)32(5)28(37-26)31-21-7-9-22(10-8-21)33-11-13-36-14-12-33/h7-10,15-18H,6,11-14H2,1-5H3/b26-16+,31-28- |
| InChIKey | AAKPQUXVFRBUCV-HSJZEISMSA-N |
| XLogP | 5.92 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|