C31H37ClN4O2S — CID 50869125
(5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-3-ethyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 50869125) has the molecular formula C31H37ClN4O2S and a molecular weight of 565.18 g/mol. Its IUPAC name is (5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-3-ethyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-3-ethyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50869125 |
| Molecular Formula | C31H37ClN4O2S |
| Molecular Weight | 565.18 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | (5E)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-3-ethyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCCN1c2cc(Cl)c(/C=C3/S/C(=N\c4ccc(N5CCOCC5)cc4)N(CC)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C31H37ClN4O2S/c1-6-12-36-27-19-26(32)22(17-25(27)21(3)20-31(36,4)5)18-28-29(37)35(7-2)30(39-28)33-23-8-10-24(11-9-23)34-13-15-38-16-14-34/h8-11,17-20H,6-7,12-16H2,1-5H3/b28-18+,33-30- |
| InChIKey | OTQDSHVUFBDWOO-WMGVAAGXSA-N |
| XLogP | 7.21 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.18 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|