C32H40N4O3S — CID 50869863
(5E)-3-ethyl-5-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 50869863) has the molecular formula C32H40N4O3S and a molecular weight of 560.76 g/mol. Its IUPAC name is (5E)-3-ethyl-5-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-5-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50869863 |
| Molecular Formula | C32H40N4O3S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | (5E)-3-ethyl-5-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCCN1c2cc(OC)c(/C=C3/S/C(=N\c4ccc(N5CCOCC5)cc4)N(CC)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C32H40N4O3S/c1-7-13-36-27-20-28(38-6)23(18-26(27)22(3)21-32(36,4)5)19-29-30(37)35(8-2)31(40-29)33-24-9-11-25(12-10-24)34-14-16-39-17-15-34/h9-12,18-21H,7-8,13-17H2,1-6H3/b29-19+,33-31- |
| InChIKey | FIEDQEQAVLUAEV-BKGREXSKSA-N |
| XLogP | 6.57 |
| TPSA | 57.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|