C30H40FN3OS — CID 50867401
(5E)-3-cyclohexyl-2-cyclohexylimino-5-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 50867401) has the molecular formula C30H40FN3OS and a molecular weight of 509.74 g/mol. Its IUPAC name is (5E)-3-cyclohexyl-2-cyclohexylimino-5-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-cyclohexyl-2-cyclohexylimino-5-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50867401 |
| Molecular Formula | C30H40FN3OS |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | (5E)-3-cyclohexyl-2-cyclohexylimino-5-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1c2cc(F)c(/C=C3/S/C(=N\C4CCCCC4)N(C4CCCCC4)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C30H40FN3OS/c1-5-33-26-18-25(31)21(16-24(26)20(2)19-30(33,3)4)17-27-28(35)34(23-14-10-7-11-15-23)29(36-27)32-22-12-8-6-9-13-22/h16-19,22-23H,5-15H2,1-4H3/b27-17+,32-29- |
| InChIKey | SZNCUHQLZQSRRV-AYOZRVFHSA-N |
| XLogP | 7.79 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|