C24H24ClN3OS — CID 136831833
(5Z)-2-(3-chlorophenyl)imino-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 136831833) has the molecular formula C24H24ClN3OS and a molecular weight of 438.00 g/mol. Its IUPAC name is (5Z)-2-(3-chlorophenyl)imino-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-chlorophenyl)imino-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136831833 |
| Molecular Formula | C24H24ClN3OS |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (5Z)-2-(3-chlorophenyl)imino-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1c2ccc(/C=C3\S/C(=N/c4cccc(Cl)c4)NC3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H24ClN3OS/c1-5-28-20-10-9-16(11-19(20)15(2)14-24(28,3)4)12-21-22(29)27-23(30-21)26-18-8-6-7-17(25)13-18/h6-14H,5H2,1-4H3,(H,26,27,29)/b21-12- |
| InChIKey | RFDODCQHQRFRCK-MTJSOVHGSA-N |
| XLogP | 6.25 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|