C21H24N4O — CID 133170834
N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]pyridine-4-carboxamide (PubChem CID 133170834) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 133170834 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]pyridine-4-carboxamide |
| SMILES | CCN1c2ccc(/C=N/NC(=O)c3ccncc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C21H24N4O/c1-5-25-19-7-6-16(12-18(19)15(2)13-21(25,3)4)14-23-24-20(26)17-8-10-22-11-9-17/h6-14H,5H2,1-4H3,(H,24,26)/b23-14+ |
| InChIKey | HKFVZSDSIKPQMF-OEAKJJBVSA-N |
| XLogP | 3.87 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|