C21H23N3O2 — CID 50864186
3-hydroxy-N-[(E)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50864186) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-hydroxy-N-[(E)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 3-hydroxy-N-[(E)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50864186 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-hydroxy-N-[(E)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CC1=CC(C)(C)N(C)c2ccc(/C=N/NC(=O)c3cccc(O)c3)cc21 |
| InChI | InChI=1S/C21H23N3O2/c1-14-12-21(2,3)24(4)19-9-8-15(10-18(14)19)13-22-23-20(26)16-6-5-7-17(25)11-16/h5-13,25H,1-4H3,(H,23,26)/b22-13+ |
| InChIKey | RNXDFXGWLPZLHY-LPYMAVHISA-N |
| XLogP | 3.79 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|