C15H20N4S — CID 50864127
[(Z)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]thiourea (PubChem CID 50864127) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is [(Z)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]thiourea.
| Compound Name | [(Z)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 50864127 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [(Z)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]thiourea |
| SMILES | CC1=CC(C)(C)N(C)c2ccc(/C=N\NC(N)=S)cc21 |
| InChI | InChI=1S/C15H20N4S/c1-10-8-15(2,3)19(4)13-6-5-11(7-12(10)13)9-17-18-14(16)20/h5-9H,1-4H3,(H3,16,18,20)/b17-9- |
| InChIKey | GWZDAJIZIIQPBL-MFOYZWKCSA-N |
| XLogP | 2.49 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|