C20H22N4O — CID 133170764
N-[(E)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]pyridine-2-carboxamide (PubChem CID 133170764) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[(E)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[(E)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 133170764 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-[(E)-(1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]pyridine-2-carboxamide |
| SMILES | CC1=CC(C)(C)N(C)c2ccc(/C=N/NC(=O)c3ccccn3)cc21 |
| InChI | InChI=1S/C20H22N4O/c1-14-12-20(2,3)24(4)18-9-8-15(11-16(14)18)13-22-23-19(25)17-7-5-6-10-21-17/h5-13H,1-4H3,(H,23,25)/b22-13+ |
| InChIKey | XOUVLMCMIOOVIE-LPYMAVHISA-N |
| XLogP | 3.48 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|