C23H26BrN3O — CID 50868220
3-bromo-N-[(Z)-(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50868220) has the molecular formula C23H26BrN3O and a molecular weight of 440.39 g/mol. Its IUPAC name is 3-bromo-N-[(Z)-(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 3-bromo-N-[(Z)-(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50868220 |
| Molecular Formula | C23H26BrN3O |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 3-bromo-N-[(Z)-(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CCCN1c2ccc(/C=N\NC(=O)c3cccc(Br)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H26BrN3O/c1-5-11-27-21-10-9-17(12-20(21)16(2)14-23(27,3)4)15-25-26-22(28)18-7-6-8-19(24)13-18/h6-10,12-15H,5,11H2,1-4H3,(H,26,28)/b25-15- |
| InChIKey | LBJLTOOZTLWXDL-MYYYXRDXSA-N |
| XLogP | 5.62 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|