C22H24N4O3 — CID 50866226
N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-4-nitrobenzamide (PubChem CID 50866226) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 50866226 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-4-nitrobenzamide |
| SMILES | CCN1c2ccc(/C=N\NC(=O)c3ccc([N+](=O)[O-])cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C22H24N4O3/c1-5-25-20-11-6-16(12-19(20)15(2)13-22(25,3)4)14-23-24-21(27)17-7-9-18(10-8-17)26(28)29/h6-14H,5H2,1-4H3,(H,24,27)/b23-14- |
| InChIKey | VMCKDJHFJUTIPW-UCQKPKSFSA-N |
| XLogP | 4.38 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|