About N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine
N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine (PubChem CID 50866223) has the molecular formula C20H23N5O2
and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine.
Molecular Properties
| Compound Name | N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine |
| PubChem CID | 50866223 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine |
| SMILES | CCN1c2ccc(/C=N\Nc3ncccc3[N+](=O)[O-])cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C20H23N5O2/c1-5-24-17-9-8-15(11-16(17)14(2)12-20(24,3)4)13-22-23-19-18(25(26)27)7-6-10-21-19/h6-13H,5H2,1-4H3,(H,21,23)/b22-13- |
| InChIKey | GTSGVDXHSSGGQS-XKZIYDEJSA-N |
| XLogP | 4.46 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine?
The IUPAC name of N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine (CID 50866223) is N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine.
What is the SMILES notation for N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine?
The canonical SMILES for N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine is CCN1c2ccc(/C=N\Nc3ncccc3[N+](=O)[O-])cc2C(C)=CC1(C)C.
What is the InChIKey of N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine?
The InChIKey is GTSGVDXHSSGGQS-XKZIYDEJSA-N. The full InChI is InChI=1S/C20H23N5O2/c1-5-24-17-9-8-15(11-16(17)14(2)12-20(24,3)4)13-22-23-19-18(25(26)27)7-6-10-21-19/h6-13H,5H2,1-4H3,(H,21,23)/b22-13-.
What are the key properties of N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine?
N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine has a molecular weight of 365.44 g/mol, XLogP of 4.46, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-nitropyridin-2-amine is sourced from PubChem (CID 50866223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).