C22H26N4O2 — CID 133170881
4-nitro-N-[(E)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]aniline (PubChem CID 133170881) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-nitro-N-[(E)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]aniline.
| Compound Name | 4-nitro-N-[(E)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 133170881 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 4-nitro-N-[(E)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]aniline |
| SMILES | CC1=CC(C)(C)N(C(C)C)c2ccc(/C=N/Nc3ccc([N+](=O)[O-])cc3)cc21 |
| InChI | InChI=1S/C22H26N4O2/c1-15(2)25-21-11-6-17(12-20(21)16(3)13-22(25,4)5)14-23-24-18-7-9-19(10-8-18)26(27)28/h6-15,24H,1-5H3/b23-14+ |
| InChIKey | GDXCYETVDNQCLW-OEAKJJBVSA-N |
| XLogP | 5.45 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|