C23H25ClN2O2 — CID 50868517
4-chloro-3-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid (PubChem CID 50868517) has the molecular formula C23H25ClN2O2 and a molecular weight of 396.92 g/mol. Its IUPAC name is 4-chloro-3-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid.
| Compound Name | 4-chloro-3-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 50868517 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-chloro-3-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid |
| SMILES | CCCN1c2ccc(/C=N/c3cc(C(=O)O)ccc3Cl)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H25ClN2O2/c1-5-10-26-21-9-6-16(11-18(21)15(2)13-23(26,3)4)14-25-20-12-17(22(27)28)7-8-19(20)24/h6-9,11-14H,5,10H2,1-4H3,(H,27,28)/b25-14+ |
| InChIKey | LSPVMEPJTXKFAK-AFUMVMLFSA-N |
| XLogP | 6.20 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|