C21H22Cl2N2O — CID 50867273
5-chloro-2-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]phenol (PubChem CID 50867273) has the molecular formula C21H22Cl2N2O and a molecular weight of 389.33 g/mol. Its IUPAC name is 5-chloro-2-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]phenol.
| Compound Name | 5-chloro-2-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]phenol |
|---|---|
| PubChem CID | 50867273 |
| Molecular Formula | C21H22Cl2N2O |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 5-chloro-2-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]phenol |
| SMILES | CCN1c2cc(Cl)c(/C=N/c3ccc(Cl)cc3O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C21H22Cl2N2O/c1-5-25-19-10-17(23)14(8-16(19)13(2)11-21(25,3)4)12-24-18-7-6-15(22)9-20(18)26/h6-12,26H,5H2,1-4H3/b24-12+ |
| InChIKey | CSYRFWBAHDGPBG-WYMPLXKRSA-N |
| XLogP | 6.47 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|