C12H9Cl2NO3 — CID 99079667
ethyl (2S)-2-cyano-3-(2,4-dichlorophenyl)-3-oxopropanoate (PubChem CID 99079667) has the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-3-(2,4-dichlorophenyl)-3-oxopropanoate.
| Compound Name | ethyl (2S)-2-cyano-3-(2,4-dichlorophenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 99079667 |
| Molecular Formula | C12H9Cl2NO3 |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | ethyl (2S)-2-cyano-3-(2,4-dichlorophenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)[C@@H](C#N)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2NO3/c1-2-18-12(17)9(6-15)11(16)8-4-3-7(13)5-10(8)14/h3-5,9H,2H2,1H3/t9-/m0/s1 |
| InChIKey | UKLIRLXUWSYHMV-VIFPVBQESA-N |
| XLogP | 2.88 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|