C14H12Cl2N2O2 — CID 47273815
2-(2,4-dichlorobenzoyl)-3-oxo-3-pyrrolidin-1-ylpropanenitrile (PubChem CID 47273815) has the molecular formula C14H12Cl2N2O2 and a molecular weight of 311.17 g/mol. Its IUPAC name is 2-(2,4-dichlorobenzoyl)-3-oxo-3-pyrrolidin-1-ylpropanenitrile.
| Compound Name | 2-(2,4-dichlorobenzoyl)-3-oxo-3-pyrrolidin-1-ylpropanenitrile |
|---|---|
| PubChem CID | 47273815 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 2-(2,4-dichlorobenzoyl)-3-oxo-3-pyrrolidin-1-ylpropanenitrile |
| SMILES | N#CC(C(=O)c1ccc(Cl)cc1Cl)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H12Cl2N2O2/c15-9-3-4-10(12(16)7-9)13(19)11(8-17)14(20)18-5-1-2-6-18/h3-4,7,11H,1-2,5-6H2 |
| InChIKey | AGAAMNLYACXCTM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|