C19H18Cl2N2O3 — CID 51361789
1-(2,4-dichlorophenyl)-2-(4-methyl-2-oxo-1-pyridinyl)-3-pyrrolidin-1-ylpropane-1,3-dione (PubChem CID 51361789) has the molecular formula C19H18Cl2N2O3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(4-methyl-2-oxo-1-pyridinyl)-3-pyrrolidin-1-ylpropane-1,3-dione.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(4-methyl-2-oxo-1-pyridinyl)-3-pyrrolidin-1-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 51361789 |
| Molecular Formula | C19H18Cl2N2O3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(4-methyl-2-oxo-1-pyridinyl)-3-pyrrolidin-1-ylpropane-1,3-dione |
| SMILES | Cc1ccn(C(C(=O)c2ccc(Cl)cc2Cl)C(=O)N2CCCC2)c(=O)c1 |
| InChI | InChI=1S/C19H18Cl2N2O3/c1-12-6-9-23(16(24)10-12)17(19(26)22-7-2-3-8-22)18(25)14-5-4-13(20)11-15(14)21/h4-6,9-11,17H,2-3,7-8H2,1H3 |
| InChIKey | RQWOZEXLUIIEPE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|