C22H18Cl2N2O3 — CID 3963036
N-benzyl-3-(2,4-dichlorophenyl)-N-methyl-3-oxo-2-(2-oxo-1-pyridinyl)propanamide (PubChem CID 3963036) has the molecular formula C22H18Cl2N2O3 and a molecular weight of 429.30 g/mol. Its IUPAC name is N-benzyl-3-(2,4-dichlorophenyl)-N-methyl-3-oxo-2-(2-oxo-1-pyridinyl)propanamide.
| Compound Name | N-benzyl-3-(2,4-dichlorophenyl)-N-methyl-3-oxo-2-(2-oxo-1-pyridinyl)propanamide |
|---|---|
| PubChem CID | 3963036 |
| Molecular Formula | C22H18Cl2N2O3 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | N-benzyl-3-(2,4-dichlorophenyl)-N-methyl-3-oxo-2-(2-oxo-1-pyridinyl)propanamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(C(=O)c1ccc(Cl)cc1Cl)n1ccccc1=O |
| InChI | InChI=1S/C22H18Cl2N2O3/c1-25(14-15-7-3-2-4-8-15)22(29)20(26-12-6-5-9-19(26)27)21(28)17-11-10-16(23)13-18(17)24/h2-13,20H,14H2,1H3 |
| InChIKey | LNOGUFMBQBUUCU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|