C23H21ClN2O4 — CID 51362607
N-benzyl-3-(4-chlorophenyl)-N-(2-hydroxyethyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide (PubChem CID 51362607) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is N-benzyl-3-(4-chlorophenyl)-N-(2-hydroxyethyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide.
| Compound Name | N-benzyl-3-(4-chlorophenyl)-N-(2-hydroxyethyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide |
|---|---|
| PubChem CID | 51362607 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-benzyl-3-(4-chlorophenyl)-N-(2-hydroxyethyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide |
| SMILES | O=C(c1ccc(Cl)cc1)C(C(=O)N(CCO)Cc1ccccc1)n1ccccc1=O |
| InChI | InChI=1S/C23H21ClN2O4/c24-19-11-9-18(10-12-19)22(29)21(26-13-5-4-8-20(26)28)23(30)25(14-15-27)16-17-6-2-1-3-7-17/h1-13,21,27H,14-16H2 |
| InChIKey | NZCKIFFPHJCNGZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|