C25H27N3O3 — CID 7297791
(2R)-N-benzyl-N-[2-(dimethylamino)ethyl]-3-oxo-2-(2-oxo-1-pyridinyl)-3-phenylpropanamide (PubChem CID 7297791) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2R)-N-benzyl-N-[2-(dimethylamino)ethyl]-3-oxo-2-(2-oxo-1-pyridinyl)-3-phenylpropanamide.
| Compound Name | (2R)-N-benzyl-N-[2-(dimethylamino)ethyl]-3-oxo-2-(2-oxo-1-pyridinyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 7297791 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (2R)-N-benzyl-N-[2-(dimethylamino)ethyl]-3-oxo-2-(2-oxo-1-pyridinyl)-3-phenylpropanamide |
| SMILES | CN(C)CCN(Cc1ccccc1)C(=O)[C@@H](C(=O)c1ccccc1)n1ccccc1=O |
| InChI | InChI=1S/C25H27N3O3/c1-26(2)17-18-27(19-20-11-5-3-6-12-20)25(31)23(28-16-10-9-15-22(28)29)24(30)21-13-7-4-8-14-21/h3-16,23H,17-19H2,1-2H3/t23-/m1/s1 |
| InChIKey | AJJCPSVITDXDTC-HSZRJFAPSA-N |
| XLogP | 2.86 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|