C19H15NO2 — CID 3828854
1-(2-oxo-1,2-diphenylethyl)pyridin-2-one (PubChem CID 3828854) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-(2-oxo-1,2-diphenylethyl)pyridin-2-one.
| Compound Name | 1-(2-oxo-1,2-diphenylethyl)pyridin-2-one |
|---|---|
| PubChem CID | 3828854 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-(2-oxo-1,2-diphenylethyl)pyridin-2-one |
| SMILES | O=C(c1ccccc1)C(c1ccccc1)n1ccccc1=O |
| InChI | InChI=1S/C19H15NO2/c21-17-13-7-8-14-20(17)18(15-9-3-1-4-10-15)19(22)16-11-5-2-6-12-16/h1-14,18H |
| InChIKey | BOUNCZHOQAMCNS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |