C20H21NO2 — CID 19049071
5-methyl-1-(2-oxo-1,2-diphenylethyl)piperidin-2-one (PubChem CID 19049071) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 5-methyl-1-(2-oxo-1,2-diphenylethyl)piperidin-2-one.
| Compound Name | 5-methyl-1-(2-oxo-1,2-diphenylethyl)piperidin-2-one |
|---|---|
| PubChem CID | 19049071 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 5-methyl-1-(2-oxo-1,2-diphenylethyl)piperidin-2-one |
| SMILES | CC1CCC(=O)N(C(C(=O)c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C20H21NO2/c1-15-12-13-18(22)21(14-15)19(16-8-4-2-5-9-16)20(23)17-10-6-3-7-11-17/h2-11,15,19H,12-14H2,1H3 |
| InChIKey | LHIKORJDKRXDDC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |