C19H14FNO2 — CID 67443871
5-fluoro-1-(2-oxo-1,2-diphenylethyl)pyridin-2-one (PubChem CID 67443871) has the molecular formula C19H14FNO2 and a molecular weight of 307.32 g/mol. Its IUPAC name is 5-fluoro-1-(2-oxo-1,2-diphenylethyl)pyridin-2-one.
| Compound Name | 5-fluoro-1-(2-oxo-1,2-diphenylethyl)pyridin-2-one |
|---|---|
| PubChem CID | 67443871 |
| Molecular Formula | C19H14FNO2 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 5-fluoro-1-(2-oxo-1,2-diphenylethyl)pyridin-2-one |
| SMILES | O=C(c1ccccc1)C(c1ccccc1)n1cc(F)ccc1=O |
| InChI | InChI=1S/C19H14FNO2/c20-16-11-12-17(22)21(13-16)18(14-7-3-1-4-8-14)19(23)15-9-5-2-6-10-15/h1-13,18H |
| InChIKey | VLLOJAUCOUYQAT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |