C18H19Cl2NO2 — CID 989933
[(2R)-1-[benzyl(methyl)amino]propan-2-yl] 2,4-dichlorobenzoate (PubChem CID 989933) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is [(2R)-1-[benzyl(methyl)amino]propan-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [(2R)-1-[benzyl(methyl)amino]propan-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 989933 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | [(2R)-1-[benzyl(methyl)amino]propan-2-yl] 2,4-dichlorobenzoate |
| SMILES | C[C@H](CN(C)Cc1ccccc1)OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2NO2/c1-13(11-21(2)12-14-6-4-3-5-7-14)23-18(22)16-9-8-15(19)10-17(16)20/h3-10,13H,11-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | KWZHWERPWGLLTG-CYBMUJFWSA-N |
| XLogP | 4.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |