About 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride
1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride (PubChem CID 17065283) has the molecular formula C18H21BrClNO2
and a molecular weight of 398.73 g/mol. Its IUPAC name is 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride.
Molecular Properties
| Compound Name | 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride |
| PubChem CID | 17065283 |
| Molecular Formula | C18H21BrClNO2 |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride |
| SMILES | CC(CN(C)Cc1ccccc1)OC(=O)c1ccccc1Br.Cl |
| InChI | InChI=1S/C18H20BrNO2.ClH/c1-14(12-20(2)13-15-8-4-3-5-9-15)22-18(21)16-10-6-7-11-17(16)19;/h3-11,14H,12-13H2,1-2H3;1H |
| InChIKey | IRUVBBHTWRDXJO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride?
The IUPAC name of 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride (CID 17065283) is 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride.
What is the SMILES notation for 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride?
The canonical SMILES for 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride is CC(CN(C)Cc1ccccc1)OC(=O)c1ccccc1Br.Cl.
What is the InChIKey of 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride?
The InChIKey is IRUVBBHTWRDXJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20BrNO2.ClH/c1-14(12-20(2)13-15-8-4-3-5-9-15)22-18(21)16-10-6-7-11-17(16)19;/h3-11,14H,12-13H2,1-2H3;1H.
What are the key properties of 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride?
1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride has a molecular weight of 398.73 g/mol, XLogP of 4.55, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[benzyl(methyl)amino]propan-2-yl 2-bromobenzoate;hydrochloride is sourced from PubChem (CID 17065283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).