C14H16Cl2N2O2 — CID 5395427
[(E)-[(2,4-dichlorophenyl)-piperidin-1-ylmethylidene]amino] acetate (PubChem CID 5395427) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is [(E)-[(2,4-dichlorophenyl)-piperidin-1-ylmethylidene]amino] acetate.
| Compound Name | [(E)-[(2,4-dichlorophenyl)-piperidin-1-ylmethylidene]amino] acetate |
|---|---|
| PubChem CID | 5395427 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | [(E)-[(2,4-dichlorophenyl)-piperidin-1-ylmethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\c1ccc(Cl)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C14H16Cl2N2O2/c1-10(19)20-17-14(18-7-3-2-4-8-18)12-6-5-11(15)9-13(12)16/h5-6,9H,2-4,7-8H2,1H3/b17-14+ |
| InChIKey | DTTJFDFWPKZSGF-SAPNQHFASA-N |
| XLogP | 3.70 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|