C19H17Cl4N3O4S — CID 19292280
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 19292280) has the molecular formula C19H17Cl4N3O4S and a molecular weight of 525.24 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 19292280 |
| Molecular Formula | C19H17Cl4N3O4S |
| Molecular Weight | 525.24 g/mol |
| Exact Mass | 522.97 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | N/C(=N\OC(=O)c1cc(S(=O)(=O)N2CCCCC2)c(Cl)cc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl4N3O4S/c20-11-4-5-12(14(21)8-11)18(24)25-30-19(27)13-9-17(16(23)10-15(13)22)31(28,29)26-6-2-1-3-7-26/h4-5,8-10H,1-3,6-7H2,(H2,24,25) |
| InChIKey | UGYDLEZGFBKWRL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|