C19H18Cl2FN3O4S — CID 19291953
[(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 19291953) has the molecular formula C19H18Cl2FN3O4S and a molecular weight of 474.34 g/mol. Its IUPAC name is [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 19291953 |
| Molecular Formula | C19H18Cl2FN3O4S |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | N/C(=N\OC(=O)c1cc(S(=O)(=O)N2CCCCC2)c(Cl)cc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18Cl2FN3O4S/c20-15-11-16(21)17(30(27,28)25-8-2-1-3-9-25)10-14(15)19(26)29-24-18(23)12-4-6-13(22)7-5-12/h4-7,10-11H,1-3,8-9H2,(H2,23,24) |
| InChIKey | MVTLVCMVLILNAV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|